C11H13BrO2S — CID 23634809
S-(4-methylphenyl) (2R,3S)-2-bromo-3-hydroxybutanethioate (PubChem CID 23634809) has the molecular formula C11H13BrO2S and a molecular weight of 289.19 g/mol. Its IUPAC name is S-(4-methylphenyl) (2R,3S)-2-bromo-3-hydroxybutanethioate.
| Compound Name | S-(4-methylphenyl) (2R,3S)-2-bromo-3-hydroxybutanethioate |
|---|---|
| PubChem CID | 23634809 |
| Molecular Formula | C11H13BrO2S |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | S-(4-methylphenyl) (2R,3S)-2-bromo-3-hydroxybutanethioate |
| SMILES | Cc1ccc(SC(=O)[C@H](Br)[C@H](C)O)cc1 |
| InChI | InChI=1S/C11H13BrO2S/c1-7-3-5-9(6-4-7)15-11(14)10(12)8(2)13/h3-6,8,10,13H,1-2H3/t8-,10+/m0/s1 |
| InChIKey | LLLJIEBVPIHNIB-WCBMZHEXSA-N |
| XLogP | 2.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|