C9H7Cl3OS — CID 14947453
S-(4-methylphenyl) 2,2,2-trichloroethanethioate (PubChem CID 14947453) has the molecular formula C9H7Cl3OS and a molecular weight of 269.58 g/mol. Its IUPAC name is S-(4-methylphenyl) 2,2,2-trichloroethanethioate.
| Compound Name | S-(4-methylphenyl) 2,2,2-trichloroethanethioate |
|---|---|
| PubChem CID | 14947453 |
| Molecular Formula | C9H7Cl3OS |
| Molecular Weight | 269.58 g/mol |
| Exact Mass | 267.93 |
| IUPAC Name | S-(4-methylphenyl) 2,2,2-trichloroethanethioate |
| SMILES | Cc1ccc(SC(=O)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C9H7Cl3OS/c1-6-2-4-7(5-3-6)14-8(13)9(10,11)12/h2-5H,1H3 |
| InChIKey | WEVNMKWJGNZHPM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|