C17H16Cl3NOS2 — CID 44786771
S-(4-methylphenyl) N-[2,2,2-trichloro-1-(4-methylphenyl)sulfanylethyl]carbamothioate (PubChem CID 44786771) has the molecular formula C17H16Cl3NOS2 and a molecular weight of 420.81 g/mol. Its IUPAC name is S-(4-methylphenyl) N-[2,2,2-trichloro-1-(4-methylphenyl)sulfanylethyl]carbamothioate.
| Compound Name | S-(4-methylphenyl) N-[2,2,2-trichloro-1-(4-methylphenyl)sulfanylethyl]carbamothioate |
|---|---|
| PubChem CID | 44786771 |
| Molecular Formula | C17H16Cl3NOS2 |
| Molecular Weight | 420.81 g/mol |
| Exact Mass | 418.97 |
| IUPAC Name | S-(4-methylphenyl) N-[2,2,2-trichloro-1-(4-methylphenyl)sulfanylethyl]carbamothioate |
| SMILES | Cc1ccc(SC(=O)NC(Sc2ccc(C)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C17H16Cl3NOS2/c1-11-3-7-13(8-4-11)23-15(17(18,19)20)21-16(22)24-14-9-5-12(2)6-10-14/h3-10,15H,1-2H3,(H,21,22) |
| InChIKey | ROFMEQPVPQGARA-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.81 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|