C19H20O2S — CID 784681
3-[(R)-(4-methylphenyl)sulfanyl-phenylmethyl]pentane-2,4-dione (PubChem CID 784681) has the molecular formula C19H20O2S and a molecular weight of 312.43 g/mol. Its IUPAC name is 3-[(R)-(4-methylphenyl)sulfanyl-phenylmethyl]pentane-2,4-dione.
| Compound Name | 3-[(R)-(4-methylphenyl)sulfanyl-phenylmethyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 784681 |
| Molecular Formula | C19H20O2S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 3-[(R)-(4-methylphenyl)sulfanyl-phenylmethyl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)[C@@H](Sc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H20O2S/c1-13-9-11-17(12-10-13)22-19(16-7-5-4-6-8-16)18(14(2)20)15(3)21/h4-12,18-19H,1-3H3/t19-/m0/s1 |
| InChIKey | QEBXKAZCXKBMGN-IBGZPJMESA-N |
| XLogP | 4.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|