C19H16Cl2N2OS2 — CID 45126736
2,2-dichloro-N-[1-cyano-2,2-bis[(4-methylphenyl)sulfanyl]ethenyl]acetamide (PubChem CID 45126736) has the molecular formula C19H16Cl2N2OS2 and a molecular weight of 423.39 g/mol. Its IUPAC name is 2,2-dichloro-N-[1-cyano-2,2-bis[(4-methylphenyl)sulfanyl]ethenyl]acetamide.
| Compound Name | 2,2-dichloro-N-[1-cyano-2,2-bis[(4-methylphenyl)sulfanyl]ethenyl]acetamide |
|---|---|
| PubChem CID | 45126736 |
| Molecular Formula | C19H16Cl2N2OS2 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | 2,2-dichloro-N-[1-cyano-2,2-bis[(4-methylphenyl)sulfanyl]ethenyl]acetamide |
| SMILES | Cc1ccc(SC(Sc2ccc(C)cc2)=C(C#N)NC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C19H16Cl2N2OS2/c1-12-3-7-14(8-4-12)25-19(16(11-22)23-18(24)17(20)21)26-15-9-5-13(2)6-10-15/h3-10,17H,1-2H3,(H,23,24) |
| InChIKey | ZASBSELWLUKUAK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|