C11H10Cl4N2O2 — CID 4120076
2,2-dichloro-N-[2-[(2,2-dichloroacetyl)amino]-4-methylphenyl]acetamide (PubChem CID 4120076) has the molecular formula C11H10Cl4N2O2 and a molecular weight of 344.03 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-[(2,2-dichloroacetyl)amino]-4-methylphenyl]acetamide.
| Compound Name | 2,2-dichloro-N-[2-[(2,2-dichloroacetyl)amino]-4-methylphenyl]acetamide |
|---|---|
| PubChem CID | 4120076 |
| Molecular Formula | C11H10Cl4N2O2 |
| Molecular Weight | 344.03 g/mol |
| Exact Mass | 341.95 |
| IUPAC Name | 2,2-dichloro-N-[2-[(2,2-dichloroacetyl)amino]-4-methylphenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)C(Cl)Cl)c(NC(=O)C(Cl)Cl)c1 |
| InChI | InChI=1S/C11H10Cl4N2O2/c1-5-2-3-6(16-10(18)8(12)13)7(4-5)17-11(19)9(14)15/h2-4,8-9H,1H3,(H,16,18)(H,17,19) |
| InChIKey | IWGSRRLNRBLWBV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.03 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|