C12H12Cl4N2O2 — CID 71443799
2,2-dichloro-N-[[(2,2-dichloroacetyl)amino]-(4-methylphenyl)methyl]acetamide (PubChem CID 71443799) has the molecular formula C12H12Cl4N2O2 and a molecular weight of 358.05 g/mol. Its IUPAC name is 2,2-dichloro-N-[[(2,2-dichloroacetyl)amino]-(4-methylphenyl)methyl]acetamide.
| Compound Name | 2,2-dichloro-N-[[(2,2-dichloroacetyl)amino]-(4-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 71443799 |
| Molecular Formula | C12H12Cl4N2O2 |
| Molecular Weight | 358.05 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 2,2-dichloro-N-[[(2,2-dichloroacetyl)amino]-(4-methylphenyl)methyl]acetamide |
| SMILES | Cc1ccc(C(NC(=O)C(Cl)Cl)NC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C12H12Cl4N2O2/c1-6-2-4-7(5-3-6)10(17-11(19)8(13)14)18-12(20)9(15)16/h2-5,8-10H,1H3,(H,17,19)(H,18,20) |
| InChIKey | WQKBIZDIQPTGSE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.05 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|