C17H20N2O — CID 70580652
2,3-bis(4-methylphenyl)propanehydrazide (PubChem CID 70580652) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 2,3-bis(4-methylphenyl)propanehydrazide.
| Compound Name | 2,3-bis(4-methylphenyl)propanehydrazide |
|---|---|
| PubChem CID | 70580652 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2,3-bis(4-methylphenyl)propanehydrazide |
| SMILES | Cc1ccc(CC(C(=O)NN)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H20N2O/c1-12-3-7-14(8-4-12)11-16(17(20)19-18)15-9-5-13(2)6-10-15/h3-10,16H,11,18H2,1-2H3,(H,19,20) |
| InChIKey | YHEDXYFSGCJAKE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|