C22H16F5NO — CID 101480409
3-(4-methylphenyl)-N-(2,3,4,5,6-pentafluorophenyl)-2-phenylpropanamide (PubChem CID 101480409) has the molecular formula C22H16F5NO and a molecular weight of 405.37 g/mol. Its IUPAC name is 3-(4-methylphenyl)-N-(2,3,4,5,6-pentafluorophenyl)-2-phenylpropanamide.
| Compound Name | 3-(4-methylphenyl)-N-(2,3,4,5,6-pentafluorophenyl)-2-phenylpropanamide |
|---|---|
| PubChem CID | 101480409 |
| Molecular Formula | C22H16F5NO |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 3-(4-methylphenyl)-N-(2,3,4,5,6-pentafluorophenyl)-2-phenylpropanamide |
| SMILES | Cc1ccc(CC(C(=O)Nc2c(F)c(F)c(F)c(F)c2F)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H16F5NO/c1-12-7-9-13(10-8-12)11-15(14-5-3-2-4-6-14)22(29)28-21-19(26)17(24)16(23)18(25)20(21)27/h2-10,15H,11H2,1H3,(H,28,29) |
| InChIKey | HDJSJZRLNKCTSG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|