C34H39NO — CID 162155664
4-(4-methylphenyl)-3-phenylbutan-2-amine;4-(4-methylphenyl)-3-phenylbutan-2-one (PubChem CID 162155664) has the molecular formula C34H39NO and a molecular weight of 477.69 g/mol. Its IUPAC name is 4-(4-methylphenyl)-3-phenylbutan-2-amine;4-(4-methylphenyl)-3-phenylbutan-2-one.
| Compound Name | 4-(4-methylphenyl)-3-phenylbutan-2-amine;4-(4-methylphenyl)-3-phenylbutan-2-one |
|---|---|
| PubChem CID | 162155664 |
| Molecular Formula | C34H39NO |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 4-(4-methylphenyl)-3-phenylbutan-2-amine;4-(4-methylphenyl)-3-phenylbutan-2-one |
| SMILES | CC(=O)C(Cc1ccc(C)cc1)c1ccccc1.Cc1ccc(CC(c2ccccc2)C(C)N)cc1 |
| InChI | InChI=1S/C17H21N.C17H18O/c2*1-13-8-10-15(11-9-13)12-17(14(2)18)16-6-4-3-5-7-16/h3-11,14,17H,12,18H2,1-2H3;3-11,17H,12H2,1-2H3 |
| InChIKey | ZLUFELMFECFUAU-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |