C16H19Cl2N — CID 23404723
(2S,3S)-4-(4-chlorophenyl)-3-phenylbutan-2-amine;hydrochloride (PubChem CID 23404723) has the molecular formula C16H19Cl2N and a molecular weight of 296.24 g/mol. Its IUPAC name is (2S,3S)-4-(4-chlorophenyl)-3-phenylbutan-2-amine;hydrochloride.
| Compound Name | (2S,3S)-4-(4-chlorophenyl)-3-phenylbutan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 23404723 |
| Molecular Formula | C16H19Cl2N |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | (2S,3S)-4-(4-chlorophenyl)-3-phenylbutan-2-amine;hydrochloride |
| SMILES | C[C@H](N)[C@@H](Cc1ccc(Cl)cc1)c1ccccc1.Cl |
| InChI | InChI=1S/C16H18ClN.ClH/c1-12(18)16(14-5-3-2-4-6-14)11-13-7-9-15(17)10-8-13;/h2-10,12,16H,11,18H2,1H3;1H/t12-,16+;/m0./s1 |
| InChIKey | FRMQIGNMWCKPMD-CVHDTDHSSA-N |
| XLogP | 4.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |