About azane;1-chloro-4-(2-phenylpropyl)benzene
azane;1-chloro-4-(2-phenylpropyl)benzene (PubChem CID 67712446) has the molecular formula C15H18ClN
and a molecular weight of 247.77 g/mol. Its IUPAC name is azane;1-chloro-4-(2-phenylpropyl)benzene.
Molecular Properties
| Compound Name | azane;1-chloro-4-(2-phenylpropyl)benzene |
| PubChem CID | 67712446 |
| Molecular Formula | C15H18ClN |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | azane;1-chloro-4-(2-phenylpropyl)benzene |
| SMILES | CC(Cc1ccc(Cl)cc1)c1ccccc1.N |
| InChI | InChI=1S/C15H15Cl.H3N/c1-12(14-5-3-2-4-6-14)11-13-7-9-15(16)10-8-13;/h2-10,12H,11H2,1H3;1H3 |
| InChIKey | PCYZSPCTDMAZIK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;1-chloro-4-(2-phenylpropyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-chloro-4-(2-phenylpropyl)benzene?
The IUPAC name of azane;1-chloro-4-(2-phenylpropyl)benzene (CID 67712446) is azane;1-chloro-4-(2-phenylpropyl)benzene.
What is the SMILES notation for azane;1-chloro-4-(2-phenylpropyl)benzene?
The canonical SMILES for azane;1-chloro-4-(2-phenylpropyl)benzene is CC(Cc1ccc(Cl)cc1)c1ccccc1.N.
What is the InChIKey of azane;1-chloro-4-(2-phenylpropyl)benzene?
The InChIKey is PCYZSPCTDMAZIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Cl.H3N/c1-12(14-5-3-2-4-6-14)11-13-7-9-15(16)10-8-13;/h2-10,12H,11H2,1H3;1H3.
What are the key properties of azane;1-chloro-4-(2-phenylpropyl)benzene?
azane;1-chloro-4-(2-phenylpropyl)benzene has a molecular weight of 247.77 g/mol, XLogP of 4.85, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-chloro-4-(2-phenylpropyl)benzene is sourced from PubChem (CID 67712446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).