C22H21ClFN — CID 19073588
3-(4-chlorophenyl)-4-(3-fluoro-4-phenylphenyl)butan-2-amine (PubChem CID 19073588) has the molecular formula C22H21ClFN and a molecular weight of 353.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-(3-fluoro-4-phenylphenyl)butan-2-amine.
| Compound Name | 3-(4-chlorophenyl)-4-(3-fluoro-4-phenylphenyl)butan-2-amine |
|---|---|
| PubChem CID | 19073588 |
| Molecular Formula | C22H21ClFN |
| Molecular Weight | 353.87 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 3-(4-chlorophenyl)-4-(3-fluoro-4-phenylphenyl)butan-2-amine |
| SMILES | CC(N)C(Cc1ccc(-c2ccccc2)c(F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClFN/c1-15(25)21(18-8-10-19(23)11-9-18)13-16-7-12-20(22(24)14-16)17-5-3-2-4-6-17/h2-12,14-15,21H,13,25H2,1H3 |
| InChIKey | FDMGOODGFSMQTI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.87 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |