C17H17ClN2O — CID 129383877
(2S,3R)-3-(1,2-benzoxazol-3-yl)-4-(4-chlorophenyl)butan-2-amine (PubChem CID 129383877) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is (2S,3R)-3-(1,2-benzoxazol-3-yl)-4-(4-chlorophenyl)butan-2-amine.
| Compound Name | (2S,3R)-3-(1,2-benzoxazol-3-yl)-4-(4-chlorophenyl)butan-2-amine |
|---|---|
| PubChem CID | 129383877 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (2S,3R)-3-(1,2-benzoxazol-3-yl)-4-(4-chlorophenyl)butan-2-amine |
| SMILES | C[C@H](N)[C@@H](Cc1ccc(Cl)cc1)c1noc2ccccc12 |
| InChI | InChI=1S/C17H17ClN2O/c1-11(19)15(10-12-6-8-13(18)9-7-12)17-14-4-2-3-5-16(14)21-20-17/h2-9,11,15H,10,19H2,1H3/t11-,15+/m0/s1 |
| InChIKey | AZTWGMCAKUVDPM-XHDPSFHLSA-N |
| XLogP | 4.15 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |