benzyl 2-(1,2-benzoxazol-3-yl)propanoate

C17H15NO3 — CID 134527830

IUPACbenzyl 2-(1,2-benzoxazol-3-yl)propanoate
SMILESCC(C(=O)OCc1ccccc1)c1noc2ccccc12
InChIInChI=1S/C17H15NO3/c1-12(16-14-9-5-6-10-15(14)21-18-16)17(19)20-11-13-7-3-2-4-8-13/h2-10,12H,11H2,1H3
InChIKeyNJKBXXDBZUWWOH-UHFFFAOYSA-N
MW281.31 g/mol
LogP3.67
Rot. Bonds4

About benzyl 2-(1,2-benzoxazol-3-yl)propanoate

benzyl 2-(1,2-benzoxazol-3-yl)propanoate (PubChem CID 134527830) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is benzyl 2-(1,2-benzoxazol-3-yl)propanoate.

Molecular Properties

Compound Namebenzyl 2-(1,2-benzoxazol-3-yl)propanoate
PubChem CID134527830
Molecular FormulaC17H15NO3
Molecular Weight281.31 g/mol
Exact Mass281.11
IUPAC Namebenzyl 2-(1,2-benzoxazol-3-yl)propanoate
SMILESCC(C(=O)OCc1ccccc1)c1noc2ccccc12
InChIInChI=1S/C17H15NO3/c1-12(16-14-9-5-6-10-15(14)21-18-16)17(19)20-11-13-7-3-2-4-8-13/h2-10,12H,11H2,1H3
InChIKeyNJKBXXDBZUWWOH-UHFFFAOYSA-N
XLogP3.67
TPSA52.33 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.31
LogP ≤ 53.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl 2-(1,2-benzoxazol-3-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-(1,2-benzoxazol-3-yl)propanoate?
The IUPAC name of benzyl 2-(1,2-benzoxazol-3-yl)propanoate (CID 134527830) is benzyl 2-(1,2-benzoxazol-3-yl)propanoate.
What is the SMILES notation for benzyl 2-(1,2-benzoxazol-3-yl)propanoate?
The canonical SMILES for benzyl 2-(1,2-benzoxazol-3-yl)propanoate is CC(C(=O)OCc1ccccc1)c1noc2ccccc12.
What is the InChIKey of benzyl 2-(1,2-benzoxazol-3-yl)propanoate?
The InChIKey is NJKBXXDBZUWWOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO3/c1-12(16-14-9-5-6-10-15(14)21-18-16)17(19)20-11-13-7-3-2-4-8-13/h2-10,12H,11H2,1H3.
What are the key properties of benzyl 2-(1,2-benzoxazol-3-yl)propanoate?
benzyl 2-(1,2-benzoxazol-3-yl)propanoate has a molecular weight of 281.31 g/mol, XLogP of 3.67, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(1,2-benzoxazol-3-yl)propanoate is sourced from PubChem (CID 134527830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).