C10H10N2O3 — CID 82396094
3-amino-2-(1,2-benzoxazol-3-yl)propanoic acid (PubChem CID 82396094) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 3-amino-2-(1,2-benzoxazol-3-yl)propanoic acid.
| Compound Name | 3-amino-2-(1,2-benzoxazol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 82396094 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3-amino-2-(1,2-benzoxazol-3-yl)propanoic acid |
| SMILES | NCC(C(=O)O)c1noc2ccccc12 |
| InChI | InChI=1S/C10H10N2O3/c11-5-7(10(13)14)9-6-3-1-2-4-8(6)15-12-9/h1-4,7H,5,11H2,(H,13,14) |
| InChIKey | ZMOFVYMVLDAKPA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |