C10H11NO4S — CID 167261210
1-(1,2-benzoxazol-3-yl)propane-1-sulfonic acid (PubChem CID 167261210) has the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. Its IUPAC name is 1-(1,2-benzoxazol-3-yl)propane-1-sulfonic acid.
| Compound Name | 1-(1,2-benzoxazol-3-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 167261210 |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 1-(1,2-benzoxazol-3-yl)propane-1-sulfonic acid |
| SMILES | CCC(c1noc2ccccc12)S(=O)(=O)O |
| InChI | InChI=1S/C10H11NO4S/c1-2-9(16(12,13)14)10-7-5-3-4-6-8(7)15-11-10/h3-6,9H,2H2,1H3,(H,12,13,14) |
| InChIKey | FRNDYZCQTXSGIK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|