C10H12N2O3S — CID 175392982
N-(1,2-benzoxazol-3-yl)propane-1-sulfonamide (PubChem CID 175392982) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is N-(1,2-benzoxazol-3-yl)propane-1-sulfonamide.
| Compound Name | N-(1,2-benzoxazol-3-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 175392982 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | N-(1,2-benzoxazol-3-yl)propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1noc2ccccc12 |
| InChI | InChI=1S/C10H12N2O3S/c1-2-7-16(13,14)12-10-8-5-3-4-6-9(8)15-11-10/h3-6H,2,7H2,1H3,(H,11,12) |
| InChIKey | IXXHQYLDWGBRCT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |