C15H27NO — CID 143892351
ethane;3-methyl-1,2-benzoxazole;propane (PubChem CID 143892351) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is ethane;3-methyl-1,2-benzoxazole;propane.
| Compound Name | ethane;3-methyl-1,2-benzoxazole;propane |
|---|---|
| PubChem CID | 143892351 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | ethane;3-methyl-1,2-benzoxazole;propane |
| SMILES | CC.CC.CCC.Cc1noc2ccccc12 |
| InChI | InChI=1S/C8H7NO.C3H8.2C2H6/c1-6-7-4-2-3-5-8(7)10-9-6;1-3-2;2*1-2/h2-5H,1H3;3H2,1-2H3;2*1-2H3 |
| InChIKey | MWOFZARTHNREHH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |