C8H7NO2 — CID 135429940
3-methyl-1,2-benzoxazol-4-ol (PubChem CID 135429940) has the molecular formula C8H7NO2 and a molecular weight of 149.15 g/mol. Its IUPAC name is 3-methyl-1,2-benzoxazol-4-ol.
| Compound Name | 3-methyl-1,2-benzoxazol-4-ol |
|---|---|
| PubChem CID | 135429940 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 3-methyl-1,2-benzoxazol-4-ol |
| SMILES | Cc1noc2cccc(O)c12 |
| InChI | InChI=1S/C8H7NO2/c1-5-8-6(10)3-2-4-7(8)11-9-5/h2-4,10H,1H3 |
| InChIKey | QJKWESZXKFJXGT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |