C9H9ClN2O — CID 117110095
(5-chloro-3-methyl-1,2-benzoxazol-4-yl)methanamine (PubChem CID 117110095) has the molecular formula C9H9ClN2O and a molecular weight of 196.64 g/mol. Its IUPAC name is (5-chloro-3-methyl-1,2-benzoxazol-4-yl)methanamine.
| Compound Name | (5-chloro-3-methyl-1,2-benzoxazol-4-yl)methanamine |
|---|---|
| PubChem CID | 117110095 |
| Molecular Formula | C9H9ClN2O |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | (5-chloro-3-methyl-1,2-benzoxazol-4-yl)methanamine |
| SMILES | Cc1noc2ccc(Cl)c(CN)c12 |
| InChI | InChI=1S/C9H9ClN2O/c1-5-9-6(4-11)7(10)2-3-8(9)13-12-5/h2-3H,4,11H2,1H3 |
| InChIKey | TVBMULRGCMTAKP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |