C9H8N2O3 — CID 15561249
3,5-dimethyl-4-nitro-1,2-benzoxazole (PubChem CID 15561249) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is 3,5-dimethyl-4-nitro-1,2-benzoxazole.
| Compound Name | 3,5-dimethyl-4-nitro-1,2-benzoxazole |
|---|---|
| PubChem CID | 15561249 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 3,5-dimethyl-4-nitro-1,2-benzoxazole |
| SMILES | Cc1ccc2onc(C)c2c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8N2O3/c1-5-3-4-7-8(6(2)10-14-7)9(5)11(12)13/h3-4H,1-2H3 |
| InChIKey | ACFHEJUHVAQGCK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|