About 5-methyl-4-nitro-1,3-benzoxazole
5-methyl-4-nitro-1,3-benzoxazole (PubChem CID 170638026) has the molecular formula C8H6N2O3
and a molecular weight of 178.15 g/mol. Its IUPAC name is 5-methyl-4-nitro-1,3-benzoxazole.
Molecular Properties
| Compound Name | 5-methyl-4-nitro-1,3-benzoxazole |
| PubChem CID | 170638026 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 5-methyl-4-nitro-1,3-benzoxazole |
| SMILES | Cc1ccc2ocnc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H6N2O3/c1-5-2-3-6-7(9-4-13-6)8(5)10(11)12/h2-4H,1H3 |
| InChIKey | KPXIQOWSKLRRNO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-4-nitro-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-nitro-1,3-benzoxazole?
The IUPAC name of 5-methyl-4-nitro-1,3-benzoxazole (CID 170638026) is 5-methyl-4-nitro-1,3-benzoxazole.
What is the SMILES notation for 5-methyl-4-nitro-1,3-benzoxazole?
The canonical SMILES for 5-methyl-4-nitro-1,3-benzoxazole is Cc1ccc2ocnc2c1[N+](=O)[O-].
What is the InChIKey of 5-methyl-4-nitro-1,3-benzoxazole?
The InChIKey is KPXIQOWSKLRRNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O3/c1-5-2-3-6-7(9-4-13-6)8(5)10(11)12/h2-4H,1H3.
What are the key properties of 5-methyl-4-nitro-1,3-benzoxazole?
5-methyl-4-nitro-1,3-benzoxazole has a molecular weight of 178.15 g/mol, XLogP of 2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-nitro-1,3-benzoxazole is sourced from PubChem (CID 170638026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).