C9H10N2O — CID 119083756
N,4-dimethyl-1,2-benzoxazol-3-amine (PubChem CID 119083756) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is N,4-dimethyl-1,2-benzoxazol-3-amine.
| Compound Name | N,4-dimethyl-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 119083756 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | N,4-dimethyl-1,2-benzoxazol-3-amine |
| SMILES | CNc1noc2cccc(C)c12 |
| InChI | InChI=1S/C9H10N2O/c1-6-4-3-5-7-8(6)9(10-2)11-12-7/h3-5H,1-2H3,(H,10,11) |
| InChIKey | MIUJNFFDOIGRDR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |