C12H13ClN2O2 — CID 67409017
N-(4-chloro-1,2-benzoxazol-3-yl)-2-methylbutanamide (PubChem CID 67409017) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is N-(4-chloro-1,2-benzoxazol-3-yl)-2-methylbutanamide.
| Compound Name | N-(4-chloro-1,2-benzoxazol-3-yl)-2-methylbutanamide |
|---|---|
| PubChem CID | 67409017 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-(4-chloro-1,2-benzoxazol-3-yl)-2-methylbutanamide |
| SMILES | CCC(C)C(=O)Nc1noc2cccc(Cl)c12 |
| InChI | InChI=1S/C12H13ClN2O2/c1-3-7(2)12(16)14-11-10-8(13)5-4-6-9(10)17-15-11/h4-7H,3H2,1-2H3,(H,14,15,16) |
| InChIKey | UVZQMWGCTNXNGA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |