C15H12ClN3O2S — CID 87436007
1-benzyl-3-[(4-chloro-1,2-benzoxazol-3-yl)sulfanyl]urea (PubChem CID 87436007) has the molecular formula C15H12ClN3O2S and a molecular weight of 333.80 g/mol. Its IUPAC name is 1-benzyl-3-[(4-chloro-1,2-benzoxazol-3-yl)sulfanyl]urea.
| Compound Name | 1-benzyl-3-[(4-chloro-1,2-benzoxazol-3-yl)sulfanyl]urea |
|---|---|
| PubChem CID | 87436007 |
| Molecular Formula | C15H12ClN3O2S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 1-benzyl-3-[(4-chloro-1,2-benzoxazol-3-yl)sulfanyl]urea |
| SMILES | O=C(NCc1ccccc1)NSc1noc2cccc(Cl)c12 |
| InChI | InChI=1S/C15H12ClN3O2S/c16-11-7-4-8-12-13(11)14(18-21-12)22-19-15(20)17-9-10-5-2-1-3-6-10/h1-8H,9H2,(H2,17,19,20) |
| InChIKey | ZJXGPRNOZXLBNT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|