C21H17ClN2O5 — CID 29498868
[2-(benzylcarbamoylamino)-2-oxoethyl] 5-(2-chlorophenyl)furan-2-carboxylate (PubChem CID 29498868) has the molecular formula C21H17ClN2O5 and a molecular weight of 412.83 g/mol. Its IUPAC name is [2-(benzylcarbamoylamino)-2-oxoethyl] 5-(2-chlorophenyl)furan-2-carboxylate.
| Compound Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 5-(2-chlorophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 29498868 |
| Molecular Formula | C21H17ClN2O5 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 5-(2-chlorophenyl)furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(-c2ccccc2Cl)o1)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H17ClN2O5/c22-16-9-5-4-8-15(16)17-10-11-18(29-17)20(26)28-13-19(25)24-21(27)23-12-14-6-2-1-3-7-14/h1-11H,12-13H2,(H2,23,24,25,27) |
| InChIKey | TXELBBWCJFYXKC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |