C19H18N4O5 — CID 55646855
[2-(benzylcarbamoylamino)-2-oxoethyl] 5-(pyrazol-1-ylmethyl)furan-2-carboxylate (PubChem CID 55646855) has the molecular formula C19H18N4O5 and a molecular weight of 382.38 g/mol. Its IUPAC name is [2-(benzylcarbamoylamino)-2-oxoethyl] 5-(pyrazol-1-ylmethyl)furan-2-carboxylate.
| Compound Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 5-(pyrazol-1-ylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 55646855 |
| Molecular Formula | C19H18N4O5 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 5-(pyrazol-1-ylmethyl)furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(Cn2cccn2)o1)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H18N4O5/c24-17(22-19(26)20-11-14-5-2-1-3-6-14)13-27-18(25)16-8-7-15(28-16)12-23-10-4-9-21-23/h1-10H,11-13H2,(H2,20,22,24,26) |
| InChIKey | DPCLBFUAGBLDPP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |