C19H27N3O4 — CID 55646764
[2-[bis(2-methylpropyl)amino]-2-oxoethyl] 5-(pyrazol-1-ylmethyl)furan-2-carboxylate (PubChem CID 55646764) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 5-(pyrazol-1-ylmethyl)furan-2-carboxylate.
| Compound Name | [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 5-(pyrazol-1-ylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 55646764 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 5-(pyrazol-1-ylmethyl)furan-2-carboxylate |
| SMILES | CC(C)CN(CC(C)C)C(=O)COC(=O)c1ccc(Cn2cccn2)o1 |
| InChI | InChI=1S/C19H27N3O4/c1-14(2)10-21(11-15(3)4)18(23)13-25-19(24)17-7-6-16(26-17)12-22-9-5-8-20-22/h5-9,14-15H,10-13H2,1-4H3 |
| InChIKey | MMECMUJPGXRIFC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 77.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |