C20H20N2O4 — CID 55646699
[2-oxo-2-(4-propan-2-ylphenyl)ethyl] 5-(pyrazol-1-ylmethyl)furan-2-carboxylate (PubChem CID 55646699) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is [2-oxo-2-(4-propan-2-ylphenyl)ethyl] 5-(pyrazol-1-ylmethyl)furan-2-carboxylate.
| Compound Name | [2-oxo-2-(4-propan-2-ylphenyl)ethyl] 5-(pyrazol-1-ylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 55646699 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [2-oxo-2-(4-propan-2-ylphenyl)ethyl] 5-(pyrazol-1-ylmethyl)furan-2-carboxylate |
| SMILES | CC(C)c1ccc(C(=O)COC(=O)c2ccc(Cn3cccn3)o2)cc1 |
| InChI | InChI=1S/C20H20N2O4/c1-14(2)15-4-6-16(7-5-15)18(23)13-25-20(24)19-9-8-17(26-19)12-22-11-3-10-21-22/h3-11,14H,12-13H2,1-2H3 |
| InChIKey | GEJSMMQSZLOIDP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |