C15H9Cl3N2O3 — CID 55753128
(2,4,6-trichlorophenyl) 5-(pyrazol-1-ylmethyl)furan-2-carboxylate (PubChem CID 55753128) has the molecular formula C15H9Cl3N2O3 and a molecular weight of 371.61 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 5-(pyrazol-1-ylmethyl)furan-2-carboxylate.
| Compound Name | (2,4,6-trichlorophenyl) 5-(pyrazol-1-ylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 55753128 |
| Molecular Formula | C15H9Cl3N2O3 |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | (2,4,6-trichlorophenyl) 5-(pyrazol-1-ylmethyl)furan-2-carboxylate |
| SMILES | O=C(Oc1c(Cl)cc(Cl)cc1Cl)c1ccc(Cn2cccn2)o1 |
| InChI | InChI=1S/C15H9Cl3N2O3/c16-9-6-11(17)14(12(18)7-9)23-15(21)13-3-2-10(22-13)8-20-5-1-4-19-20/h1-7H,8H2 |
| InChIKey | HJOHWMOXZLVVQE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|