About quinolin-8-ylmethyl 5-(pyrazol-1-ylmethyl)furan-2-carboxylate
quinolin-8-ylmethyl 5-(pyrazol-1-ylmethyl)furan-2-carboxylate (PubChem CID 55646497) has the molecular formula C19H15N3O3
and a molecular weight of 333.35 g/mol. Its IUPAC name is quinolin-8-ylmethyl 5-(pyrazol-1-ylmethyl)furan-2-carboxylate.
Molecular Properties
| Compound Name | quinolin-8-ylmethyl 5-(pyrazol-1-ylmethyl)furan-2-carboxylate |
| PubChem CID | 55646497 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | quinolin-8-ylmethyl 5-(pyrazol-1-ylmethyl)furan-2-carboxylate |
| SMILES | O=C(OCc1cccc2cccnc12)c1ccc(Cn2cccn2)o1 |
| InChI | InChI=1S/C19H15N3O3/c23-19(17-8-7-16(25-17)12-22-11-3-10-21-22)24-13-15-5-1-4-14-6-2-9-20-18(14)15/h1-11H,12-13H2 |
| InChIKey | ZBPJDOUXDJVDOV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze quinolin-8-ylmethyl 5-(pyrazol-1-ylmethyl)furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-ylmethyl 5-(pyrazol-1-ylmethyl)furan-2-carboxylate?
The IUPAC name of quinolin-8-ylmethyl 5-(pyrazol-1-ylmethyl)furan-2-carboxylate (CID 55646497) is quinolin-8-ylmethyl 5-(pyrazol-1-ylmethyl)furan-2-carboxylate.
What is the SMILES notation for quinolin-8-ylmethyl 5-(pyrazol-1-ylmethyl)furan-2-carboxylate?
The canonical SMILES for quinolin-8-ylmethyl 5-(pyrazol-1-ylmethyl)furan-2-carboxylate is O=C(OCc1cccc2cccnc12)c1ccc(Cn2cccn2)o1.
What is the InChIKey of quinolin-8-ylmethyl 5-(pyrazol-1-ylmethyl)furan-2-carboxylate?
The InChIKey is ZBPJDOUXDJVDOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O3/c23-19(17-8-7-16(25-17)12-22-11-3-10-21-22)24-13-15-5-1-4-14-6-2-9-20-18(14)15/h1-11H,12-13H2.
What are the key properties of quinolin-8-ylmethyl 5-(pyrazol-1-ylmethyl)furan-2-carboxylate?
quinolin-8-ylmethyl 5-(pyrazol-1-ylmethyl)furan-2-carboxylate has a molecular weight of 333.35 g/mol, XLogP of 3.43, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-ylmethyl 5-(pyrazol-1-ylmethyl)furan-2-carboxylate is sourced from PubChem (CID 55646497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).