About quinolin-8-ylmethyl 3-hydroxybenzoate
quinolin-8-ylmethyl 3-hydroxybenzoate (PubChem CID 17392700) has the molecular formula C17H13NO3
and a molecular weight of 279.30 g/mol. Its IUPAC name is quinolin-8-ylmethyl 3-hydroxybenzoate.
Molecular Properties
| Compound Name | quinolin-8-ylmethyl 3-hydroxybenzoate |
| PubChem CID | 17392700 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | quinolin-8-ylmethyl 3-hydroxybenzoate |
| SMILES | O=C(OCc1cccc2cccnc12)c1cccc(O)c1 |
| InChI | InChI=1S/C17H13NO3/c19-15-8-2-5-13(10-15)17(20)21-11-14-6-1-4-12-7-3-9-18-16(12)14/h1-10,19H,11H2 |
| InChIKey | BVKOYYAMEKEQOI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze quinolin-8-ylmethyl 3-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-ylmethyl 3-hydroxybenzoate?
The IUPAC name of quinolin-8-ylmethyl 3-hydroxybenzoate (CID 17392700) is quinolin-8-ylmethyl 3-hydroxybenzoate.
What is the SMILES notation for quinolin-8-ylmethyl 3-hydroxybenzoate?
The canonical SMILES for quinolin-8-ylmethyl 3-hydroxybenzoate is O=C(OCc1cccc2cccnc12)c1cccc(O)c1.
What is the InChIKey of quinolin-8-ylmethyl 3-hydroxybenzoate?
The InChIKey is BVKOYYAMEKEQOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO3/c19-15-8-2-5-13(10-15)17(20)21-11-14-6-1-4-12-7-3-9-18-16(12)14/h1-10,19H,11H2.
What are the key properties of quinolin-8-ylmethyl 3-hydroxybenzoate?
quinolin-8-ylmethyl 3-hydroxybenzoate has a molecular weight of 279.30 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-ylmethyl 3-hydroxybenzoate is sourced from PubChem (CID 17392700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).