C19H20N2O6 — CID 2122372
[2-(benzylcarbamoylamino)-2-oxoethyl] 2,6-dimethoxybenzoate (PubChem CID 2122372) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is [2-(benzylcarbamoylamino)-2-oxoethyl] 2,6-dimethoxybenzoate.
| Compound Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 2,6-dimethoxybenzoate |
|---|---|
| PubChem CID | 2122372 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 2,6-dimethoxybenzoate |
| SMILES | COc1cccc(OC)c1C(=O)OCC(=O)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H20N2O6/c1-25-14-9-6-10-15(26-2)17(14)18(23)27-12-16(22)21-19(24)20-11-13-7-4-3-5-8-13/h3-10H,11-12H2,1-2H3,(H2,20,21,22,24) |
| InChIKey | PBBVMTRXQZNZAR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |