C15H11ClN2O3 — CID 67407982
2-chloro-N-(4-methoxy-1,2-benzoxazol-3-yl)benzamide (PubChem CID 67407982) has the molecular formula C15H11ClN2O3 and a molecular weight of 302.72 g/mol. Its IUPAC name is 2-chloro-N-(4-methoxy-1,2-benzoxazol-3-yl)benzamide.
| Compound Name | 2-chloro-N-(4-methoxy-1,2-benzoxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 67407982 |
| Molecular Formula | C15H11ClN2O3 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-chloro-N-(4-methoxy-1,2-benzoxazol-3-yl)benzamide |
| SMILES | COc1cccc2onc(NC(=O)c3ccccc3Cl)c12 |
| InChI | InChI=1S/C15H11ClN2O3/c1-20-11-7-4-8-12-13(11)14(18-21-12)17-15(19)9-5-2-3-6-10(9)16/h2-8H,1H3,(H,17,18,19) |
| InChIKey | YVCPQVAWAIPDCV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |