C16H16ClNO4 — CID 912702
N-(2-chlorophenyl)-2,4,5-trimethoxybenzamide (PubChem CID 912702) has the molecular formula C16H16ClNO4 and a molecular weight of 321.76 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2,4,5-trimethoxybenzamide.
| Compound Name | N-(2-chlorophenyl)-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 912702 |
| Molecular Formula | C16H16ClNO4 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-(2-chlorophenyl)-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C16H16ClNO4/c1-20-13-9-15(22-3)14(21-2)8-10(13)16(19)18-12-7-5-4-6-11(12)17/h4-9H,1-3H3,(H,18,19) |
| InChIKey | KALKPSRYVKQNJZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |