C16H16ClNO5 — CID 837991
N-(5-chloro-2-hydroxyphenyl)-2,4,5-trimethoxybenzamide (PubChem CID 837991) has the molecular formula C16H16ClNO5 and a molecular weight of 337.76 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-2,4,5-trimethoxybenzamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 837991 |
| Molecular Formula | C16H16ClNO5 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2cc(Cl)ccc2O)cc1OC |
| InChI | InChI=1S/C16H16ClNO5/c1-21-13-8-15(23-3)14(22-2)7-10(13)16(20)18-11-6-9(17)4-5-12(11)19/h4-8,19H,1-3H3,(H,18,20) |
| InChIKey | QXCWFGASZZWGRD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|