C19H20ClNO4 — CID 56581323
N-(5-chloro-2-hydroxyphenyl)-4-cyclopentyloxy-3-methoxybenzamide (PubChem CID 56581323) has the molecular formula C19H20ClNO4 and a molecular weight of 361.83 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-4-cyclopentyloxy-3-methoxybenzamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-4-cyclopentyloxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 56581323 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-4-cyclopentyloxy-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2cc(Cl)ccc2O)ccc1OC1CCCC1 |
| InChI | InChI=1S/C19H20ClNO4/c1-24-18-10-12(6-9-17(18)25-14-4-2-3-5-14)19(23)21-15-11-13(20)7-8-16(15)22/h6-11,14,22H,2-5H2,1H3,(H,21,23) |
| InChIKey | NAYBOKXUTGDYES-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|