C23H28N2O6S — CID 55820947
4-cyclopentyloxy-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-methoxybenzamide (PubChem CID 55820947) has the molecular formula C23H28N2O6S and a molecular weight of 460.55 g/mol. Its IUPAC name is 4-cyclopentyloxy-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-methoxybenzamide.
| Compound Name | 4-cyclopentyloxy-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 55820947 |
| Molecular Formula | C23H28N2O6S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 4-cyclopentyloxy-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2cc(S(=O)(=O)N3CCCC3)ccc2O)ccc1OC1CCCC1 |
| InChI | InChI=1S/C23H28N2O6S/c1-30-22-14-16(8-11-21(22)31-17-6-2-3-7-17)23(27)24-19-15-18(9-10-20(19)26)32(28,29)25-12-4-5-13-25/h8-11,14-15,17,26H,2-7,12-13H2,1H3,(H,24,27) |
| InChIKey | KFJCSDNXSQOOED-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|