C17H16ClIN2O4 — CID 60619805
N-(2-acetamido-5-chlorophenyl)-2-iodo-4,5-dimethoxybenzamide (PubChem CID 60619805) has the molecular formula C17H16ClIN2O4 and a molecular weight of 474.68 g/mol. Its IUPAC name is N-(2-acetamido-5-chlorophenyl)-2-iodo-4,5-dimethoxybenzamide.
| Compound Name | N-(2-acetamido-5-chlorophenyl)-2-iodo-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 60619805 |
| Molecular Formula | C17H16ClIN2O4 |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 473.98 |
| IUPAC Name | N-(2-acetamido-5-chlorophenyl)-2-iodo-4,5-dimethoxybenzamide |
| SMILES | COc1cc(I)c(C(=O)Nc2cc(Cl)ccc2NC(C)=O)cc1OC |
| InChI | InChI=1S/C17H16ClIN2O4/c1-9(22)20-13-5-4-10(18)6-14(13)21-17(23)11-7-15(24-2)16(25-3)8-12(11)19/h4-8H,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | TZSHCUVOGPCPQE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|