C19H22N4O3S — CID 87432888
1-[4-(diethylamino)phenyl]-3-(4-methoxy-1,2-benzoxazol-3-yl)-1-sulfanylurea (PubChem CID 87432888) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-3-(4-methoxy-1,2-benzoxazol-3-yl)-1-sulfanylurea.
| Compound Name | 1-[4-(diethylamino)phenyl]-3-(4-methoxy-1,2-benzoxazol-3-yl)-1-sulfanylurea |
|---|---|
| PubChem CID | 87432888 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-3-(4-methoxy-1,2-benzoxazol-3-yl)-1-sulfanylurea |
| SMILES | CCN(CC)c1ccc(N(S)C(=O)Nc2noc3cccc(OC)c23)cc1 |
| InChI | InChI=1S/C19H22N4O3S/c1-4-22(5-2)13-9-11-14(12-10-13)23(27)19(24)20-18-17-15(25-3)7-6-8-16(17)26-21-18/h6-12,27H,4-5H2,1-3H3,(H,20,21,24) |
| InChIKey | UJZBERVZIXVATF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|