C14H14F3N3O5S — CID 87432512
methyl 2-[sulfanyl-[[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]carbamoyl]amino]propanoate (PubChem CID 87432512) has the molecular formula C14H14F3N3O5S and a molecular weight of 393.34 g/mol. Its IUPAC name is methyl 2-[sulfanyl-[[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]carbamoyl]amino]propanoate.
| Compound Name | methyl 2-[sulfanyl-[[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]carbamoyl]amino]propanoate |
|---|---|
| PubChem CID | 87432512 |
| Molecular Formula | C14H14F3N3O5S |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | methyl 2-[sulfanyl-[[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]carbamoyl]amino]propanoate |
| SMILES | COC(=O)C(C)N(S)C(=O)Nc1noc2cccc(OCC(F)(F)F)c12 |
| InChI | InChI=1S/C14H14F3N3O5S/c1-7(12(21)23-2)20(26)13(22)18-11-10-8(24-6-14(15,16)17)4-3-5-9(10)25-19-11/h3-5,7,26H,6H2,1-2H3,(H,18,19,22) |
| InChIKey | QKTXEVVNIDVQPF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|