C16H14N2O4 — CID 42545360
3-methoxy-N-(4-methoxy-1,2-benzoxazol-3-yl)benzamide (PubChem CID 42545360) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 3-methoxy-N-(4-methoxy-1,2-benzoxazol-3-yl)benzamide.
| Compound Name | 3-methoxy-N-(4-methoxy-1,2-benzoxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 42545360 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-methoxy-N-(4-methoxy-1,2-benzoxazol-3-yl)benzamide |
| SMILES | COc1cccc(C(=O)Nc2noc3cccc(OC)c23)c1 |
| InChI | InChI=1S/C16H14N2O4/c1-20-11-6-3-5-10(9-11)16(19)17-15-14-12(21-2)7-4-8-13(14)22-18-15/h3-9H,1-2H3,(H,17,18,19) |
| InChIKey | DQESRWDLLVOFCX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |