C10H11NO2 — CID 119094129
6-ethoxy-3-methyl-1,2-benzoxazole (PubChem CID 119094129) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 6-ethoxy-3-methyl-1,2-benzoxazole.
| Compound Name | 6-ethoxy-3-methyl-1,2-benzoxazole |
|---|---|
| PubChem CID | 119094129 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 6-ethoxy-3-methyl-1,2-benzoxazole |
| SMILES | CCOc1ccc2c(C)noc2c1 |
| InChI | InChI=1S/C10H11NO2/c1-3-12-8-4-5-9-7(2)11-13-10(9)6-8/h4-6H,3H2,1-2H3 |
| InChIKey | LMENCWIMMWTXIV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |