C17H13F2NO4 — CID 54100658
ethyl 2-[[3-(2,6-difluorophenyl)-1,2-benzoxazol-6-yl]oxy]acetate (PubChem CID 54100658) has the molecular formula C17H13F2NO4 and a molecular weight of 333.29 g/mol. Its IUPAC name is ethyl 2-[[3-(2,6-difluorophenyl)-1,2-benzoxazol-6-yl]oxy]acetate.
| Compound Name | ethyl 2-[[3-(2,6-difluorophenyl)-1,2-benzoxazol-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 54100658 |
| Molecular Formula | C17H13F2NO4 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | ethyl 2-[[3-(2,6-difluorophenyl)-1,2-benzoxazol-6-yl]oxy]acetate |
| SMILES | CCOC(=O)COc1ccc2c(-c3c(F)cccc3F)noc2c1 |
| InChI | InChI=1S/C17H13F2NO4/c1-2-22-15(21)9-23-10-6-7-11-14(8-10)24-20-17(11)16-12(18)4-3-5-13(16)19/h3-8H,2,9H2,1H3 |
| InChIKey | NAHDGRFXVPIMNC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |