About 3-ethoxy-6-methyl-1,2-benzoxazole
3-ethoxy-6-methyl-1,2-benzoxazole (PubChem CID 118491983) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 3-ethoxy-6-methyl-1,2-benzoxazole.
Molecular Properties
| Compound Name | 3-ethoxy-6-methyl-1,2-benzoxazole |
| PubChem CID | 118491983 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 3-ethoxy-6-methyl-1,2-benzoxazole |
| SMILES | CCOc1noc2cc(C)ccc12 |
| InChI | InChI=1S/C10H11NO2/c1-3-12-10-8-5-4-7(2)6-9(8)13-11-10/h4-6H,3H2,1-2H3 |
| InChIKey | XYDRTPWBWKMOCA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethoxy-6-methyl-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-6-methyl-1,2-benzoxazole?
The IUPAC name of 3-ethoxy-6-methyl-1,2-benzoxazole (CID 118491983) is 3-ethoxy-6-methyl-1,2-benzoxazole.
What is the SMILES notation for 3-ethoxy-6-methyl-1,2-benzoxazole?
The canonical SMILES for 3-ethoxy-6-methyl-1,2-benzoxazole is CCOc1noc2cc(C)ccc12.
What is the InChIKey of 3-ethoxy-6-methyl-1,2-benzoxazole?
The InChIKey is XYDRTPWBWKMOCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-3-12-10-8-5-4-7(2)6-9(8)13-11-10/h4-6H,3H2,1-2H3.
What are the key properties of 3-ethoxy-6-methyl-1,2-benzoxazole?
3-ethoxy-6-methyl-1,2-benzoxazole has a molecular weight of 177.20 g/mol, XLogP of 2.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-6-methyl-1,2-benzoxazole is sourced from PubChem (CID 118491983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).