C10H10N2O3 — CID 2726312
1,2-benzoxazol-3-yl N,N-dimethylcarbamate (PubChem CID 2726312) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 1,2-benzoxazol-3-yl N,N-dimethylcarbamate.
| Compound Name | 1,2-benzoxazol-3-yl N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 2726312 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 1,2-benzoxazol-3-yl N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1noc2ccccc12 |
| InChI | InChI=1S/C10H10N2O3/c1-12(2)10(13)14-9-7-5-3-4-6-8(7)15-11-9/h3-6H,1-2H3 |
| InChIKey | CDLCMSLYICKBFX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |