C11H13N3O4 — CID 67733596
[(2R)-2-amino-3-(1,2-benzoxazol-3-yloxy)propyl] carbamate (PubChem CID 67733596) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is [(2R)-2-amino-3-(1,2-benzoxazol-3-yloxy)propyl] carbamate.
| Compound Name | [(2R)-2-amino-3-(1,2-benzoxazol-3-yloxy)propyl] carbamate |
|---|---|
| PubChem CID | 67733596 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | [(2R)-2-amino-3-(1,2-benzoxazol-3-yloxy)propyl] carbamate |
| SMILES | NC(=O)OC[C@H](N)COc1noc2ccccc12 |
| InChI | InChI=1S/C11H13N3O4/c12-7(6-17-11(13)15)5-16-10-8-3-1-2-4-9(8)18-14-10/h1-4,7H,5-6,12H2,(H2,13,15)/t7-/m1/s1 |
| InChIKey | ZOQJAKFJFNWYNV-SSDOTTSWSA-N |
| XLogP | 0.63 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |