C15H14N2O3 — CID 23368384
3-[1-amino-2-(1,2-benzoxazol-3-yloxy)ethyl]phenol (PubChem CID 23368384) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 3-[1-amino-2-(1,2-benzoxazol-3-yloxy)ethyl]phenol.
| Compound Name | 3-[1-amino-2-(1,2-benzoxazol-3-yloxy)ethyl]phenol |
|---|---|
| PubChem CID | 23368384 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-[1-amino-2-(1,2-benzoxazol-3-yloxy)ethyl]phenol |
| SMILES | NC(COc1noc2ccccc12)c1cccc(O)c1 |
| InChI | InChI=1S/C15H14N2O3/c16-13(10-4-3-5-11(18)8-10)9-19-15-12-6-1-2-7-14(12)20-17-15/h1-8,13,18H,9,16H2 |
| InChIKey | HQLSXJMXKAAXMY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |