C15H13ClN2O3 — CID 23368377
3-[1-amino-2-[(5-chloro-1,2-benzoxazol-3-yl)oxy]ethyl]phenol (PubChem CID 23368377) has the molecular formula C15H13ClN2O3 and a molecular weight of 304.73 g/mol. Its IUPAC name is 3-[1-amino-2-[(5-chloro-1,2-benzoxazol-3-yl)oxy]ethyl]phenol.
| Compound Name | 3-[1-amino-2-[(5-chloro-1,2-benzoxazol-3-yl)oxy]ethyl]phenol |
|---|---|
| PubChem CID | 23368377 |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-[1-amino-2-[(5-chloro-1,2-benzoxazol-3-yl)oxy]ethyl]phenol |
| SMILES | NC(COc1noc2ccc(Cl)cc12)c1cccc(O)c1 |
| InChI | InChI=1S/C15H13ClN2O3/c16-10-4-5-14-12(7-10)15(18-21-14)20-8-13(17)9-2-1-3-11(19)6-9/h1-7,13,19H,8,17H2 |
| InChIKey | IWUJPNVOIKLXRW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |